C13H22N2O — CID 134567557
N-methyl-N-[(3E,5Z)-5-methyl-3-(methylamino)nona-1,3,5-trien-2-yl]formamide (PubChem CID 134567557) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is N-methyl-N-[(3E,5Z)-5-methyl-3-(methylamino)nona-1,3,5-trien-2-yl]formamide.
| Compound Name | N-methyl-N-[(3E,5Z)-5-methyl-3-(methylamino)nona-1,3,5-trien-2-yl]formamide |
|---|---|
| PubChem CID | 134567557 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | N-methyl-N-[(3E,5Z)-5-methyl-3-(methylamino)nona-1,3,5-trien-2-yl]formamide |
| SMILES | C=C(/C(=C\C(C)=C/CCC)NC)N(C)C=O |
| InChI | InChI=1S/C13H22N2O/c1-6-7-8-11(2)9-13(14-4)12(3)15(5)10-16/h8-10,14H,3,6-7H2,1-2,4-5H3/b11-8-,13-9+ |
| InChIKey | LRBHFTIZLXGQFK-ZXXZFBTCSA-N |
| XLogP | 2.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|