C11H23N3 — CID 134567684
(E)-1-N,1-N,5-N,4-tetramethyl-3-methyliminohex-4-ene-1,5-diamine (PubChem CID 134567684) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is (E)-1-N,1-N,5-N,4-tetramethyl-3-methyliminohex-4-ene-1,5-diamine.
| Compound Name | (E)-1-N,1-N,5-N,4-tetramethyl-3-methyliminohex-4-ene-1,5-diamine |
|---|---|
| PubChem CID | 134567684 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | (E)-1-N,1-N,5-N,4-tetramethyl-3-methyliminohex-4-ene-1,5-diamine |
| SMILES | C/N=C(CCN(C)C)/C(C)=C(\C)NC |
| InChI | InChI=1S/C11H23N3/c1-9(10(2)12-3)11(13-4)7-8-14(5)6/h12H,7-8H2,1-6H3/b10-9+,13-11+ |
| InChIKey | MHGYJTZDGXAFCD-SNMPHBPQSA-N |
| XLogP | 1.52 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|