About (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine
(4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine (PubChem CID 134567853) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine |
| PubChem CID | 134567853 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine |
| SMILES | COCCCCN1C[C@@H](C)CO1 |
| InChI | InChI=1S/C9H19NO2/c1-9-7-10(12-8-9)5-3-4-6-11-2/h9H,3-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | WCLYNQKBRXGPST-SECBINFHSA-N |
| XLogP | 1.30 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine?
The IUPAC name of (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine (CID 134567853) is (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine.
What is the SMILES notation for (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine?
The canonical SMILES for (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine is COCCCCN1C[C@@H](C)CO1.
What is the InChIKey of (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine?
The InChIKey is WCLYNQKBRXGPST-SECBINFHSA-N. The full InChI is InChI=1S/C9H19NO2/c1-9-7-10(12-8-9)5-3-4-6-11-2/h9H,3-8H2,1-2H3/t9-/m1/s1.
What are the key properties of (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine?
(4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine has a molecular weight of 173.26 g/mol, XLogP of 1.30, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-(4-methoxybutyl)-4-methyl-1,2-oxazolidine is sourced from PubChem (CID 134567853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).