C18H28N2O2 — CID 134567873
methyl (2Z,3E,7E)-8-amino-7-methyl-5-methylimino-4-[(Z)-prop-1-enyl]-2-propylidenenona-3,7-dienoate (PubChem CID 134567873) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is methyl (2Z,3E,7E)-8-amino-7-methyl-5-methylimino-4-[(Z)-prop-1-enyl]-2-propylidenenona-3,7-dienoate.
| Compound Name | methyl (2Z,3E,7E)-8-amino-7-methyl-5-methylimino-4-[(Z)-prop-1-enyl]-2-propylidenenona-3,7-dienoate |
|---|---|
| PubChem CID | 134567873 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | methyl (2Z,3E,7E)-8-amino-7-methyl-5-methylimino-4-[(Z)-prop-1-enyl]-2-propylidenenona-3,7-dienoate |
| SMILES | C/C=C\C(=C/C(=C/CC)C(=O)OC)\C(C/C(C)=C(\C)N)=N\C |
| InChI | InChI=1S/C18H28N2O2/c1-7-9-15(12-16(10-8-2)18(21)22-6)17(20-5)11-13(3)14(4)19/h7,9-10,12H,8,11,19H2,1-6H3/b9-7-,14-13+,15-12+,16-10-,20-17+ |
| InChIKey | BSSHPYBAFZJSOB-CPAUEKRESA-N |
| XLogP | 3.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|