C15H11BrClN3OS — CID 1345680
N-[(5-bromo-2-pyridinyl)carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 1345680) has the molecular formula C15H11BrClN3OS and a molecular weight of 396.70 g/mol. Its IUPAC name is N-[(5-bromo-2-pyridinyl)carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | N-[(5-bromo-2-pyridinyl)carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1345680 |
| Molecular Formula | C15H11BrClN3OS |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 394.95 |
| IUPAC Name | N-[(5-bromo-2-pyridinyl)carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)NC(=S)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C15H11BrClN3OS/c16-11-4-7-13(18-9-11)19-15(22)20-14(21)8-3-10-1-5-12(17)6-2-10/h1-9H,(H2,18,19,20,21,22) |
| InChIKey | INRKONIHSPEOPK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|