C23H41NO3 — CID 134568320
tert-butyl N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propan-2-yl]carbamate (PubChem CID 134568320) has the molecular formula C23H41NO3 and a molecular weight of 379.59 g/mol. Its IUPAC name is tert-butyl N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 134568320 |
| Molecular Formula | C23H41NO3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | tert-butyl N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propan-2-yl]carbamate |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COCC(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H41NO3/c1-18(2)11-9-12-19(3)13-10-14-20(4)15-16-26-17-21(5)24-22(25)27-23(6,7)8/h11,13,15,21H,9-10,12,14,16-17H2,1-8H3,(H,24,25)/b19-13+,20-15+ |
| InChIKey | REYOVCXWXAPDPR-YLYRKCBPSA-N |
| XLogP | 6.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|