C26H45N3S — CID 134568326
N-[1-[(2Z,6E)-3-(2-ethenylhydrazinyl)-7,11-dimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]-3-methylhexa-1,5-dien-2-amine (PubChem CID 134568326) has the molecular formula C26H45N3S and a molecular weight of 431.73 g/mol. Its IUPAC name is N-[1-[(2Z,6E)-3-(2-ethenylhydrazinyl)-7,11-dimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]-3-methylhexa-1,5-dien-2-amine.
| Compound Name | N-[1-[(2Z,6E)-3-(2-ethenylhydrazinyl)-7,11-dimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]-3-methylhexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 134568326 |
| Molecular Formula | C26H45N3S |
| Molecular Weight | 431.73 g/mol |
| Exact Mass | 431.33 |
| IUPAC Name | N-[1-[(2Z,6E)-3-(2-ethenylhydrazinyl)-7,11-dimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]-3-methylhexa-1,5-dien-2-amine |
| SMILES | C=CCC(C)C(=C)NC(C)CSC/C=C(/CC/C=C(\C)CCC=C(C)C)NNC=C |
| InChI | InChI=1S/C26H45N3S/c1-9-13-23(6)25(8)28-24(7)20-30-19-18-26(29-27-10-2)17-12-16-22(5)15-11-14-21(3)4/h9-10,14,16,18,23-24,27-29H,1-2,8,11-13,15,17,19-20H2,3-7H3/b22-16+,26-18- |
| InChIKey | RGBRBGKXCRMQCB-YAWFJDJOSA-N |
| XLogP | 7.02 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.73 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|