C25H38F3NS — CID 134568369
(3E)-5,5,5-trifluoro-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]penta-1,3-dien-2-amine (PubChem CID 134568369) has the molecular formula C25H38F3NS and a molecular weight of 441.65 g/mol. Its IUPAC name is (3E)-5,5,5-trifluoro-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]penta-1,3-dien-2-amine.
| Compound Name | (3E)-5,5,5-trifluoro-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]penta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 134568369 |
| Molecular Formula | C25H38F3NS |
| Molecular Weight | 441.65 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | (3E)-5,5,5-trifluoro-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]penta-1,3-dien-2-amine |
| SMILES | C=C(/C=C/C(F)(F)F)NC(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=C)C |
| InChI | InChI=1S/C25H38F3NS/c1-19(2)10-8-11-21(5)12-9-13-22(6)15-17-30-18-24(20(3)4)29-23(7)14-16-25(26,27)28/h10,12,14-16,24,29H,3,7-9,11,13,17-18H2,1-2,4-6H3/b16-14+,21-12+,22-15+ |
| InChIKey | GWMPAXWHJNXORS-OHBJPFSTSA-N |
| XLogP | 8.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.65 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|