C24H39NS — CID 134568403
(3E)-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hexa-1,3,5-trien-2-amine (PubChem CID 134568403) has the molecular formula C24H39NS and a molecular weight of 373.65 g/mol. Its IUPAC name is (3E)-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 134568403 |
| Molecular Formula | C24H39NS |
| Molecular Weight | 373.65 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | (3E)-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hexa-1,3,5-trien-2-amine |
| SMILES | C=C/C=C/C(=C)NC(C)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C24H39NS/c1-8-9-16-23(6)25-24(7)19-26-18-17-22(5)15-11-14-21(4)13-10-12-20(2)3/h8-9,12,14,16-17,24-25H,1,6,10-11,13,15,18-19H2,2-5,7H3/b16-9+,21-14+,22-17+ |
| InChIKey | SRWYIXUKOFYVIH-GVFRPWJDSA-N |
| XLogP | 7.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.65 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|