C28H50N2S — CID 134568422
5-methyl-3-N-prop-1-en-2-yl-2-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hex-1-ene-2,3-diamine (PubChem CID 134568422) has the molecular formula C28H50N2S and a molecular weight of 446.79 g/mol. Its IUPAC name is 5-methyl-3-N-prop-1-en-2-yl-2-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hex-1-ene-2,3-diamine.
| Compound Name | 5-methyl-3-N-prop-1-en-2-yl-2-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hex-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 134568422 |
| Molecular Formula | C28H50N2S |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 446.37 |
| IUPAC Name | 5-methyl-3-N-prop-1-en-2-yl-2-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]hex-1-ene-2,3-diamine |
| SMILES | C=C(C)NC(CC(C)C)C(=C)NC(C)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C28H50N2S/c1-21(2)13-11-14-24(7)15-12-16-25(8)17-18-31-20-26(9)30-27(10)28(19-22(3)4)29-23(5)6/h13,15,17,22,26,28-30H,5,10-12,14,16,18-20H2,1-4,6-9H3/b24-15+,25-17+ |
| InChIKey | ZYRGOMUYVLJCCO-WXCFVEPLSA-N |
| XLogP | 8.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|