C26H41NS — CID 134568442
(3E)-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,3,5-trien-2-amine (PubChem CID 134568442) has the molecular formula C26H41NS and a molecular weight of 399.69 g/mol. Its IUPAC name is (3E)-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 134568442 |
| Molecular Formula | C26H41NS |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | (3E)-N-[3-methyl-1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylbut-3-en-2-yl]hexa-1,3,5-trien-2-amine |
| SMILES | C=C/C=C/C(=C)NC(CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=C)C |
| InChI | InChI=1S/C26H41NS/c1-9-10-17-25(8)27-26(22(4)5)20-28-19-18-24(7)16-12-15-23(6)14-11-13-21(2)3/h9-10,13,15,17-18,26-27H,1,4,8,11-12,14,16,19-20H2,2-3,5-7H3/b17-10+,23-15+,24-18+ |
| InChIKey | GZELYQAFGVBSNH-ZITXSBDTSA-N |
| XLogP | 7.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|