C18H33NS — CID 134568448
1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-amine (PubChem CID 134568448) has the molecular formula C18H33NS and a molecular weight of 295.54 g/mol. Its IUPAC name is 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-amine.
| Compound Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 134568448 |
| Molecular Formula | C18H33NS |
| Molecular Weight | 295.54 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-amine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CSCC(C)N |
| InChI | InChI=1S/C18H33NS/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-20-14-18(5)19/h8,10,12,18H,6-7,9,11,13-14,19H2,1-5H3/b16-10+,17-12+ |
| InChIKey | WCZHKOBPYZVICO-JTCWOHKRSA-N |
| XLogP | 5.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|