C22H38N2O2S — CID 134568483
4-nitro-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]but-1-en-2-amine (PubChem CID 134568483) has the molecular formula C22H38N2O2S and a molecular weight of 394.63 g/mol. Its IUPAC name is 4-nitro-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]but-1-en-2-amine.
| Compound Name | 4-nitro-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]but-1-en-2-amine |
|---|---|
| PubChem CID | 134568483 |
| Molecular Formula | C22H38N2O2S |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 4-nitro-N-[1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylpropan-2-yl]but-1-en-2-amine |
| SMILES | C=C(CC[N+](=O)[O-])NC(C)CSC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H38N2O2S/c1-18(2)9-7-10-19(3)11-8-12-20(4)14-16-27-17-22(6)23-21(5)13-15-24(25)26/h9,11,14,22-23H,5,7-8,10,12-13,15-17H2,1-4,6H3/b19-11+,20-14+ |
| InChIKey | BYYMNWOQTGHAHZ-CXBQNDLOSA-N |
| XLogP | 6.30 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|