C31H59NS — CID 134568497
5-methylidene-N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hept-1-en-2-amine (PubChem CID 134568497) has the molecular formula C31H59NS and a molecular weight of 477.89 g/mol. Its IUPAC name is 5-methylidene-N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hept-1-en-2-amine.
| Compound Name | 5-methylidene-N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hept-1-en-2-amine |
|---|---|
| PubChem CID | 134568497 |
| Molecular Formula | C31H59NS |
| Molecular Weight | 477.89 g/mol |
| Exact Mass | 477.44 |
| IUPAC Name | 5-methylidene-N-[1-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]sulfanylpropan-2-yl]hept-1-en-2-amine |
| SMILES | C=C(CC)CCC(=C)NC(C)CSC/C=C(\C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C31H59NS/c1-10-26(4)20-21-30(8)32-31(9)24-33-23-22-29(7)19-13-18-28(6)17-12-16-27(5)15-11-14-25(2)3/h22,25,27-28,31-32H,4,8,10-21,23-24H2,1-3,5-7,9H3/b29-22+ |
| InChIKey | MWDOHRPOMFSZIL-QUPMIFSKSA-N |
| XLogP | 10.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.89 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|