C21H35NO5S — CID 134568555
(2R)-2-(oxaloamino)-3-[(2E)-3,6,7,11-tetramethyldodeca-2,10-dienyl]sulfanylpropanoic acid (PubChem CID 134568555) has the molecular formula C21H35NO5S and a molecular weight of 413.58 g/mol. Its IUPAC name is (2R)-2-(oxaloamino)-3-[(2E)-3,6,7,11-tetramethyldodeca-2,10-dienyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-(oxaloamino)-3-[(2E)-3,6,7,11-tetramethyldodeca-2,10-dienyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 134568555 |
| Molecular Formula | C21H35NO5S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (2R)-2-(oxaloamino)-3-[(2E)-3,6,7,11-tetramethyldodeca-2,10-dienyl]sulfanylpropanoic acid |
| SMILES | CC(C)=CCCC(C)C(C)CC/C(C)=C/CSC[C@H](NC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H35NO5S/c1-14(2)7-6-8-16(4)17(5)10-9-15(3)11-12-28-13-18(20(24)25)22-19(23)21(26)27/h7,11,16-18H,6,8-10,12-13H2,1-5H3,(H,22,23)(H,24,25)(H,26,27)/b15-11+/t16?,17?,18-/m0/s1 |
| InChIKey | HZDRNWWWVOHKIA-WHTPCVDLSA-N |
| XLogP | 4.12 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|