C16H29NO — CID 134568838
(6E,7Z)-6-ethylidene-9-methyl-2-(propylamino)deca-7,9-dien-5-ol (PubChem CID 134568838) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (6E,7Z)-6-ethylidene-9-methyl-2-(propylamino)deca-7,9-dien-5-ol.
| Compound Name | (6E,7Z)-6-ethylidene-9-methyl-2-(propylamino)deca-7,9-dien-5-ol |
|---|---|
| PubChem CID | 134568838 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (6E,7Z)-6-ethylidene-9-methyl-2-(propylamino)deca-7,9-dien-5-ol |
| SMILES | C=C(C)/C=C\C(=C/C)C(O)CCC(C)NCCC |
| InChI | InChI=1S/C16H29NO/c1-6-12-17-14(5)9-11-16(18)15(7-2)10-8-13(3)4/h7-8,10,14,16-18H,3,6,9,11-12H2,1-2,4-5H3/b10-8-,15-7+ |
| InChIKey | NTUOFXIQYLKYHU-SRTZDBFQSA-N |
| XLogP | 3.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|