About (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine
(E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine (PubChem CID 134568846) has the molecular formula C23H47NO
and a molecular weight of 353.64 g/mol. Its IUPAC name is (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine.
Molecular Properties
| Compound Name | (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine |
| PubChem CID | 134568846 |
| Molecular Formula | C23H47NO |
| Molecular Weight | 353.64 g/mol |
| Exact Mass | 353.37 |
| IUPAC Name | (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine |
| SMILES | CC/C=C/C(CC)CCC(CC)CC(CC)CCC(C)NOCCC |
| InChI | InChI=1S/C23H47NO/c1-7-12-13-21(9-3)16-17-23(11-5)19-22(10-4)15-14-20(6)24-25-18-8-2/h12-13,20-24H,7-11,14-19H2,1-6H3/b13-12+ |
| InChIKey | RIYDAHPDIOFHQI-OUKQBFOZSA-N |
| XLogP | 7.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine?
The IUPAC name of (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine (CID 134568846) is (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine.
What is the SMILES notation for (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine?
The canonical SMILES for (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine is CC/C=C/C(CC)CCC(CC)CC(CC)CCC(C)NOCCC.
What is the InChIKey of (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine?
The InChIKey is RIYDAHPDIOFHQI-OUKQBFOZSA-N. The full InChI is InChI=1S/C23H47NO/c1-7-12-13-21(9-3)16-17-23(11-5)19-22(10-4)15-14-20(6)24-25-18-8-2/h12-13,20-24H,7-11,14-19H2,1-6H3/b13-12+.
What are the key properties of (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine?
(E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine has a molecular weight of 353.64 g/mol, XLogP of 7.30, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,7,10-triethyl-N-propoxytetradec-11-en-2-amine is sourced from PubChem (CID 134568846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).