C20H29N3O2 — CID 134569028
(2R)-2-[[[2-methyl-5-(3-phenylpropoxy)pyrimidin-4-yl]amino]methyl]pentan-1-ol (PubChem CID 134569028) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (2R)-2-[[[2-methyl-5-(3-phenylpropoxy)pyrimidin-4-yl]amino]methyl]pentan-1-ol.
| Compound Name | (2R)-2-[[[2-methyl-5-(3-phenylpropoxy)pyrimidin-4-yl]amino]methyl]pentan-1-ol |
|---|---|
| PubChem CID | 134569028 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (2R)-2-[[[2-methyl-5-(3-phenylpropoxy)pyrimidin-4-yl]amino]methyl]pentan-1-ol |
| SMILES | CCC[C@@H](CO)CNc1nc(C)ncc1OCCCc1ccccc1 |
| InChI | InChI=1S/C20H29N3O2/c1-3-8-18(15-24)13-22-20-19(14-21-16(2)23-20)25-12-7-11-17-9-5-4-6-10-17/h4-6,9-10,14,18,24H,3,7-8,11-13,15H2,1-2H3,(H,21,22,23)/t18-/m1/s1 |
| InChIKey | UQTNMXUTUZYCRN-GOSISDBHSA-N |
| XLogP | 3.62 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|