C22H33N3S — CID 134569149
5-[(3E,7Z,9Z)-3-methyl-6-methylideneundeca-3,7,9-trienyl]-6-(pentan-2-ylamino)-1H-pyrimidine-2-thione (PubChem CID 134569149) has the molecular formula C22H33N3S and a molecular weight of 371.59 g/mol. Its IUPAC name is 5-[(3E,7Z,9Z)-3-methyl-6-methylideneundeca-3,7,9-trienyl]-6-(pentan-2-ylamino)-1H-pyrimidine-2-thione.
| Compound Name | 5-[(3E,7Z,9Z)-3-methyl-6-methylideneundeca-3,7,9-trienyl]-6-(pentan-2-ylamino)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 134569149 |
| Molecular Formula | C22H33N3S |
| Molecular Weight | 371.59 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 5-[(3E,7Z,9Z)-3-methyl-6-methylideneundeca-3,7,9-trienyl]-6-(pentan-2-ylamino)-1H-pyrimidine-2-thione |
| SMILES | C=C(/C=C\C=C/C)C/C=C(\C)CCc1cnc(=S)[nH]c1NC(C)CCC |
| InChI | InChI=1S/C22H33N3S/c1-6-8-9-11-17(3)12-13-18(4)14-15-20-16-23-22(26)25-21(20)24-19(5)10-7-2/h6,8-9,11,13,16,19H,3,7,10,12,14-15H2,1-2,4-5H3,(H2,23,24,25,26)/b8-6-,11-9-,18-13+ |
| InChIKey | RIOHINSLQSQILK-OCOYUQFVSA-N |
| XLogP | 6.70 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|