C46H30N4OS — CID 134569553
(16Z,18Z)-14-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]-20-methylidene-10-oxa-14-azatetracyclo[11.7.0.03,11.04,9]icosa-1(13),2,4,6,8,11,16,18-octaene (PubChem CID 134569553) has the molecular formula C46H30N4OS and a molecular weight of 686.84 g/mol. Its IUPAC name is (16Z,18Z)-14-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]-20-methylidene-10-oxa-14-azatetracyclo[11.7.0.03,11.04,9]icosa-1(13),2,4,6,8,11,16,18-octaene.
| Compound Name | (16Z,18Z)-14-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]-20-methylidene-10-oxa-14-azatetracyclo[11.7.0.03,11.04,9]icosa-1(13),2,4,6,8,11,16,18-octaene |
|---|---|
| PubChem CID | 134569553 |
| Molecular Formula | C46H30N4OS |
| Molecular Weight | 686.84 g/mol |
| Exact Mass | 686.21 |
| IUPAC Name | (16Z,18Z)-14-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]-20-methylidene-10-oxa-14-azatetracyclo[11.7.0.03,11.04,9]icosa-1(13),2,4,6,8,11,16,18-octaene |
| SMILES | C=C1/C=C\C=C/CN(c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c3sc4ccccc4c3c2)c2cc3oc4ccccc4c3cc21 |
| InChI | InChI=1S/C46H30N4OS/c1-29-15-5-4-14-24-50(39-28-41-36(27-35(29)39)33-20-10-12-22-40(33)51-41)32-25-37-34-21-11-13-23-42(34)52-43(37)38(26-32)46-48-44(30-16-6-2-7-17-30)47-45(49-46)31-18-8-3-9-19-31/h2-23,25-28H,1,24H2/b14-4-,15-5- |
| InChIKey | UAYRDDSTFYLMAX-WPXFVRNCSA-N |
| XLogP | 12.42 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.84 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |