C12H15F3S — CID 134569633
2,4,5-trimethyl-1-(2,2,2-trifluoroethylsulfanyl)cyclohepta-1,3,5-triene (PubChem CID 134569633) has the molecular formula C12H15F3S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2,4,5-trimethyl-1-(2,2,2-trifluoroethylsulfanyl)cyclohepta-1,3,5-triene.
| Compound Name | 2,4,5-trimethyl-1-(2,2,2-trifluoroethylsulfanyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 134569633 |
| Molecular Formula | C12H15F3S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2,4,5-trimethyl-1-(2,2,2-trifluoroethylsulfanyl)cyclohepta-1,3,5-triene |
| SMILES | CC1=CCC(SCC(F)(F)F)=C(C)C=C1C |
| InChI | InChI=1S/C12H15F3S/c1-8-4-5-11(10(3)6-9(8)2)16-7-12(13,14)15/h4,6H,5,7H2,1-3H3 |
| InChIKey | NTEVQSBWTJFSKR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |