C11H8Cl2F6N2S — CID 134569678
N-[2,4-dichloro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-2,2,2-trifluoro-N'-methylethanimidamide (PubChem CID 134569678) has the molecular formula C11H8Cl2F6N2S and a molecular weight of 385.16 g/mol. Its IUPAC name is N-[2,4-dichloro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-2,2,2-trifluoro-N'-methylethanimidamide.
| Compound Name | N-[2,4-dichloro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-2,2,2-trifluoro-N'-methylethanimidamide |
|---|---|
| PubChem CID | 134569678 |
| Molecular Formula | C11H8Cl2F6N2S |
| Molecular Weight | 385.16 g/mol |
| Exact Mass | 383.97 |
| IUPAC Name | N-[2,4-dichloro-5-(2,2,2-trifluoroethylsulfanyl)phenyl]-2,2,2-trifluoro-N'-methylethanimidamide |
| SMILES | C/N=C(/Nc1cc(SCC(F)(F)F)c(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C11H8Cl2F6N2S/c1-20-9(11(17,18)19)21-7-3-8(6(13)2-5(7)12)22-4-10(14,15)16/h2-3H,4H2,1H3,(H,20,21) |
| InChIKey | BKJCJZXBMHWBQF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.16 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|