About 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene
4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene (PubChem CID 134569680) has the molecular formula C11H16F2S
and a molecular weight of 218.31 g/mol. Its IUPAC name is 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene |
| PubChem CID | 134569680 |
| Molecular Formula | C11H16F2S |
| Molecular Weight | 218.31 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene |
| SMILES | CC1=C(SCC(C)F)CC(C)C(F)=C1 |
| InChI | InChI=1S/C11H16F2S/c1-7-5-11(14-6-9(3)12)8(2)4-10(7)13/h4,7,9H,5-6H2,1-3H3 |
| InChIKey | ZPVOLMMNVVASSV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene?
The IUPAC name of 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene (CID 134569680) is 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene is CC1=C(SCC(C)F)CC(C)C(F)=C1.
What is the InChIKey of 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene?
The InChIKey is ZPVOLMMNVVASSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2S/c1-7-5-11(14-6-9(3)12)8(2)4-10(7)13/h4,7,9H,5-6H2,1-3H3.
What are the key properties of 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene?
4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene has a molecular weight of 218.31 g/mol, XLogP of 4.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-(2-fluoropropylsulfanyl)-2,5-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 134569680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).