C10H15ClN2 — CID 134569738
1-[(3E,4Z)-6-chloro-3-ethylidenehepta-1,4,6-trien-2-yl]-2-methylhydrazine (PubChem CID 134569738) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is 1-[(3E,4Z)-6-chloro-3-ethylidenehepta-1,4,6-trien-2-yl]-2-methylhydrazine.
| Compound Name | 1-[(3E,4Z)-6-chloro-3-ethylidenehepta-1,4,6-trien-2-yl]-2-methylhydrazine |
|---|---|
| PubChem CID | 134569738 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-[(3E,4Z)-6-chloro-3-ethylidenehepta-1,4,6-trien-2-yl]-2-methylhydrazine |
| SMILES | C=C(Cl)/C=C\C(=C/C)C(=C)NNC |
| InChI | InChI=1S/C10H15ClN2/c1-5-10(7-6-8(2)11)9(3)13-12-4/h5-7,12-13H,2-3H2,1,4H3/b7-6-,10-5+ |
| InChIKey | ASEKYTXTEYXCCI-JQEGGOPCSA-N |
| XLogP | 2.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|