C45H32N3OP — CID 134569765
[4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]phenyl]-diphenylphosphane (PubChem CID 134569765) has the molecular formula C45H32N3OP and a molecular weight of 661.75 g/mol. Its IUPAC name is [4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]phenyl]-diphenylphosphane.
| Compound Name | [4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]phenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 134569765 |
| Molecular Formula | C45H32N3OP |
| Molecular Weight | 661.75 g/mol |
| Exact Mass | 661.23 |
| IUPAC Name | [4-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenoxy]phenyl]phenyl]-diphenylphosphane |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(Oc4ccc(-c5ccc(P(c6ccccc6)c6ccccc6)cc5)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C45H32N3OP/c1-5-13-35(14-6-1)43-46-44(36-15-7-2-8-16-36)48-45(47-43)37-23-29-39(30-24-37)49-38-27-21-33(22-28-38)34-25-31-42(32-26-34)50(40-17-9-3-10-18-40)41-19-11-4-12-20-41/h1-32H |
| InChIKey | UNYHSXDCQJQIBT-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.75 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|