C10H13F3S — CID 134569800
(3E,4Z)-3-ethylidene-7,7,7-trifluoro-2-methylsulfanylhepta-1,4-diene (PubChem CID 134569800) has the molecular formula C10H13F3S and a molecular weight of 222.27 g/mol. Its IUPAC name is (3E,4Z)-3-ethylidene-7,7,7-trifluoro-2-methylsulfanylhepta-1,4-diene.
| Compound Name | (3E,4Z)-3-ethylidene-7,7,7-trifluoro-2-methylsulfanylhepta-1,4-diene |
|---|---|
| PubChem CID | 134569800 |
| Molecular Formula | C10H13F3S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (3E,4Z)-3-ethylidene-7,7,7-trifluoro-2-methylsulfanylhepta-1,4-diene |
| SMILES | C=C(SC)C(/C=C\CC(F)(F)F)=C/C |
| InChI | InChI=1S/C10H13F3S/c1-4-9(8(2)14-3)6-5-7-10(11,12)13/h4-6H,2,7H2,1,3H3/b6-5-,9-4+ |
| InChIKey | OCUDZLRROOZWJO-CXBDEZGUSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|