About (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide
(2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide (PubChem CID 134569862) has the molecular formula C12H22N2O2S
and a molecular weight of 258.39 g/mol. Its IUPAC name is (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide.
Molecular Properties
| Compound Name | (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide |
| PubChem CID | 134569862 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide |
| SMILES | C=CSC[C@H](NC(=O)CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C12H22N2O2S/c1-5-11(15)13-10(9-17-8-4)12(16)14(6-2)7-3/h8,10H,4-7,9H2,1-3H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | SDQVROIASUAJQP-JTQLQIEISA-N |
| XLogP | 1.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide?
The IUPAC name of (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide (CID 134569862) is (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide.
What is the SMILES notation for (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide?
The canonical SMILES for (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide is C=CSC[C@H](NC(=O)CC)C(=O)N(CC)CC.
What is the InChIKey of (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide?
The InChIKey is SDQVROIASUAJQP-JTQLQIEISA-N. The full InChI is InChI=1S/C12H22N2O2S/c1-5-11(15)13-10(9-17-8-4)12(16)14(6-2)7-3/h8,10H,4-7,9H2,1-3H3,(H,13,15)/t10-/m0/s1.
What are the key properties of (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide?
(2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide has a molecular weight of 258.39 g/mol, XLogP of 1.63, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-ethenylsulfanyl-N,N-diethyl-2-(propanoylamino)propanamide is sourced from PubChem (CID 134569862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).