C21H25N3O5S — CID 134570047
ethyl 3-(3-amino-3-hydroxypropyl)-5-methyl-2,4-dioxo-1-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 134570047) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is ethyl 3-(3-amino-3-hydroxypropyl)-5-methyl-2,4-dioxo-1-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 3-(3-amino-3-hydroxypropyl)-5-methyl-2,4-dioxo-1-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 134570047 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | ethyl 3-(3-amino-3-hydroxypropyl)-5-methyl-2,4-dioxo-1-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1sc2c(c1C)c(=O)n(CCC(N)O)c(=O)n2CCc1ccccc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-3-29-20(27)17-13(2)16-18(26)23(12-10-15(22)25)21(28)24(19(16)30-17)11-9-14-7-5-4-6-8-14/h4-8,15,25H,3,9-12,22H2,1-2H3 |
| InChIKey | YKXMVMWOQRMXON-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|