C28H43FN6O4 — CID 134570216
[(3R,5S)-5-[[[1-(2-fluorophenyl)-5-(4-methoxybutyl)triazol-4-yl]-hydroxymethyl]-(2-methylpropyl)amino]piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 134570216) has the molecular formula C28H43FN6O4 and a molecular weight of 546.69 g/mol. Its IUPAC name is [(3R,5S)-5-[[[1-(2-fluorophenyl)-5-(4-methoxybutyl)triazol-4-yl]-hydroxymethyl]-(2-methylpropyl)amino]piperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3R,5S)-5-[[[1-(2-fluorophenyl)-5-(4-methoxybutyl)triazol-4-yl]-hydroxymethyl]-(2-methylpropyl)amino]piperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 134570216 |
| Molecular Formula | C28H43FN6O4 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | [(3R,5S)-5-[[[1-(2-fluorophenyl)-5-(4-methoxybutyl)triazol-4-yl]-hydroxymethyl]-(2-methylpropyl)amino]piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | COCCCCc1c(C(O)N(CC(C)C)[C@@H]2CNC[C@H](C(=O)N3CCOCC3)C2)nnn1-c1ccccc1F |
| InChI | InChI=1S/C28H43FN6O4/c1-20(2)19-34(22-16-21(17-30-18-22)27(36)33-11-14-39-15-12-33)28(37)26-25(10-6-7-13-38-3)35(32-31-26)24-9-5-4-8-23(24)29/h4-5,8-9,20-22,28,30,37H,6-7,10-19H2,1-3H3/t21-,22+,28?/m1/s1 |
| InChIKey | UUXAUERYNUXLFJ-YDOMFUIGSA-N |
| XLogP | 2.16 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|