C14H24N2O — CID 134570627
N-(3,4-dihydropyridin-4-ylmethyl)-2,2-dimethylhexanamide (PubChem CID 134570627) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-(3,4-dihydropyridin-4-ylmethyl)-2,2-dimethylhexanamide.
| Compound Name | N-(3,4-dihydropyridin-4-ylmethyl)-2,2-dimethylhexanamide |
|---|---|
| PubChem CID | 134570627 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N-(3,4-dihydropyridin-4-ylmethyl)-2,2-dimethylhexanamide |
| SMILES | CCCCC(C)(C)C(=O)NCC1C=CN=CC1 |
| InChI | InChI=1S/C14H24N2O/c1-4-5-8-14(2,3)13(17)16-11-12-6-9-15-10-7-12/h6,9-10,12H,4-5,7-8,11H2,1-3H3,(H,16,17) |
| InChIKey | ALLHNFSZKCEAFJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |