About 7-pyridin-2-yl-1,4-dioxonan-7-amine
7-pyridin-2-yl-1,4-dioxonan-7-amine (PubChem CID 134570717) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 7-pyridin-2-yl-1,4-dioxonan-7-amine.
Molecular Properties
| Compound Name | 7-pyridin-2-yl-1,4-dioxonan-7-amine |
| PubChem CID | 134570717 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 7-pyridin-2-yl-1,4-dioxonan-7-amine |
| SMILES | NC1(c2ccccn2)CCOCCOCC1 |
| InChI | InChI=1S/C12H18N2O2/c13-12(11-3-1-2-6-14-11)4-7-15-9-10-16-8-5-12/h1-3,6H,4-5,7-10,13H2 |
| InChIKey | CEXDUVBTWCNANM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-pyridin-2-yl-1,4-dioxonan-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-pyridin-2-yl-1,4-dioxonan-7-amine?
The IUPAC name of 7-pyridin-2-yl-1,4-dioxonan-7-amine (CID 134570717) is 7-pyridin-2-yl-1,4-dioxonan-7-amine.
What is the SMILES notation for 7-pyridin-2-yl-1,4-dioxonan-7-amine?
The canonical SMILES for 7-pyridin-2-yl-1,4-dioxonan-7-amine is NC1(c2ccccn2)CCOCCOCC1.
What is the InChIKey of 7-pyridin-2-yl-1,4-dioxonan-7-amine?
The InChIKey is CEXDUVBTWCNANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c13-12(11-3-1-2-6-14-11)4-7-15-9-10-16-8-5-12/h1-3,6H,4-5,7-10,13H2.
What are the key properties of 7-pyridin-2-yl-1,4-dioxonan-7-amine?
7-pyridin-2-yl-1,4-dioxonan-7-amine has a molecular weight of 222.29 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-pyridin-2-yl-1,4-dioxonan-7-amine is sourced from PubChem (CID 134570717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).