About CID 13457075
CID 13457075 (PubChem CID 13457075) has the molecular formula C18H28O6
and a molecular weight of 340.42 g/mol.
Molecular Properties
| Compound Name | CID 13457075 |
| PubChem CID | 13457075 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | — |
| SMILES | O[C@@H]1[C@@H](O)[C@@H]2OC3(CCCCC3)O[C@@H]2[C@@H]2OC3(CCCCC3)O[C@H]12 |
| InChI | InChI=1S/C18H28O6/c19-11-12(20)14-16(24-18(22-14)9-5-2-6-10-18)15-13(11)21-17(23-15)7-3-1-4-8-17/h11-16,19-20H,1-10H2/t11-,12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | PHAPESVEHHOBEI-FWXGHANASA-N |
| XLogP | 1.61 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 13457075 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 13457075?
The IUPAC name of CID 13457075 (CID 13457075) is not available.
What is the SMILES notation for CID 13457075?
The canonical SMILES for CID 13457075 is O[C@@H]1[C@@H](O)[C@@H]2OC3(CCCCC3)O[C@@H]2[C@@H]2OC3(CCCCC3)O[C@H]12.
What is the InChIKey of CID 13457075?
The InChIKey is PHAPESVEHHOBEI-FWXGHANASA-N. The full InChI is InChI=1S/C18H28O6/c19-11-12(20)14-16(24-18(22-14)9-5-2-6-10-18)15-13(11)21-17(23-15)7-3-1-4-8-17/h11-16,19-20H,1-10H2/t11-,12-,13-,14+,15-,16+/m1/s1.
What are the key properties of CID 13457075?
CID 13457075 has a molecular weight of 340.42 g/mol, XLogP of 1.61, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 13457075 is sourced from PubChem (CID 13457075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).