About (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride
(2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride (PubChem CID 134570791) has the molecular formula C7H10F3NO
and a molecular weight of 181.16 g/mol. Its IUPAC name is (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride.
Molecular Properties
| Compound Name | (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride |
| PubChem CID | 134570791 |
| Molecular Formula | C7H10F3NO |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride |
| SMILES | CN1CCC(F)(F)C[C@H]1C(=O)F |
| InChI | InChI=1S/C7H10F3NO/c1-11-3-2-7(9,10)4-5(11)6(8)12/h5H,2-4H2,1H3/t5-/m0/s1 |
| InChIKey | LZKFSYURUQVTGL-YFKPBYRVSA-N |
| XLogP | 1.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride?
The IUPAC name of (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride (CID 134570791) is (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride.
What is the SMILES notation for (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride?
The canonical SMILES for (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride is CN1CCC(F)(F)C[C@H]1C(=O)F.
What is the InChIKey of (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride?
The InChIKey is LZKFSYURUQVTGL-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H10F3NO/c1-11-3-2-7(9,10)4-5(11)6(8)12/h5H,2-4H2,1H3/t5-/m0/s1.
What are the key properties of (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride?
(2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride has a molecular weight of 181.16 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4,4-difluoro-1-methylpiperidine-2-carbonyl fluoride is sourced from PubChem (CID 134570791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).