About 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine
8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine (PubChem CID 134571051) has the molecular formula C11H22FN
and a molecular weight of 187.30 g/mol. Its IUPAC name is 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine.
Molecular Properties
| Compound Name | 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine |
| PubChem CID | 134571051 |
| Molecular Formula | C11H22FN |
| Molecular Weight | 187.30 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine |
| SMILES | C=C(C(C)C)C(CCCCF)NC |
| InChI | InChI=1S/C11H22FN/c1-9(2)10(3)11(13-4)7-5-6-8-12/h9,11,13H,3,5-8H2,1-2,4H3 |
| InChIKey | WAEXNXQXCRVEIA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine?
The IUPAC name of 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine (CID 134571051) is 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine.
What is the SMILES notation for 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine?
The canonical SMILES for 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine is C=C(C(C)C)C(CCCCF)NC.
What is the InChIKey of 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine?
The InChIKey is WAEXNXQXCRVEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22FN/c1-9(2)10(3)11(13-4)7-5-6-8-12/h9,11,13H,3,5-8H2,1-2,4H3.
What are the key properties of 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine?
8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine has a molecular weight of 187.30 g/mol, XLogP of 2.93, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-N,2-dimethyl-3-methylideneoctan-4-amine is sourced from PubChem (CID 134571051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).