About 3-tert-butyl-4,5-dihydro-1H-indole
3-tert-butyl-4,5-dihydro-1H-indole (PubChem CID 134571127) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 3-tert-butyl-4,5-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-tert-butyl-4,5-dihydro-1H-indole |
| PubChem CID | 134571127 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 3-tert-butyl-4,5-dihydro-1H-indole |
| SMILES | CC(C)(C)c1c[nH]c2c1CCC=C2 |
| InChI | InChI=1S/C12H17N/c1-12(2,3)10-8-13-11-7-5-4-6-9(10)11/h5,7-8,13H,4,6H2,1-3H3 |
| InChIKey | BYYATNISPLMWGV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-tert-butyl-4,5-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-4,5-dihydro-1H-indole?
The IUPAC name of 3-tert-butyl-4,5-dihydro-1H-indole (CID 134571127) is 3-tert-butyl-4,5-dihydro-1H-indole.
What is the SMILES notation for 3-tert-butyl-4,5-dihydro-1H-indole?
The canonical SMILES for 3-tert-butyl-4,5-dihydro-1H-indole is CC(C)(C)c1c[nH]c2c1CCC=C2.
What is the InChIKey of 3-tert-butyl-4,5-dihydro-1H-indole?
The InChIKey is BYYATNISPLMWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-12(2,3)10-8-13-11-7-5-4-6-9(10)11/h5,7-8,13H,4,6H2,1-3H3.
What are the key properties of 3-tert-butyl-4,5-dihydro-1H-indole?
3-tert-butyl-4,5-dihydro-1H-indole has a molecular weight of 175.28 g/mol, XLogP of 3.27, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-4,5-dihydro-1H-indole is sourced from PubChem (CID 134571127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).