C8H16O5S — CID 134571167
(2R)-6-(hydroxymethyl)-2-methyl-5-methylsulfanyloxyoxane-3,4-diol (PubChem CID 134571167) has the molecular formula C8H16O5S and a molecular weight of 224.28 g/mol. Its IUPAC name is (2R)-6-(hydroxymethyl)-2-methyl-5-methylsulfanyloxyoxane-3,4-diol.
| Compound Name | (2R)-6-(hydroxymethyl)-2-methyl-5-methylsulfanyloxyoxane-3,4-diol |
|---|---|
| PubChem CID | 134571167 |
| Molecular Formula | C8H16O5S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (2R)-6-(hydroxymethyl)-2-methyl-5-methylsulfanyloxyoxane-3,4-diol |
| SMILES | CSOC1C(CO)O[C@H](C)C(O)C1O |
| InChI | InChI=1S/C8H16O5S/c1-4-6(10)7(11)8(13-14-2)5(3-9)12-4/h4-11H,3H2,1-2H3/t4-,5?,6?,7?,8?/m1/s1 |
| InChIKey | SZHPORCKSFYBGK-BKJPEWSUSA-N |
| XLogP | -0.85 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|