C18H25F2N2O8P — CID 134571190
propan-2-yl (2R)-4-[[(4aR,6R,7aR)-7,7-difluoro-6-(4-methyl-2-oxopyrimidin-1-yl)-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate (PubChem CID 134571190) has the molecular formula C18H25F2N2O8P and a molecular weight of 466.37 g/mol. Its IUPAC name is propan-2-yl (2R)-4-[[(4aR,6R,7aR)-7,7-difluoro-6-(4-methyl-2-oxopyrimidin-1-yl)-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate.
| Compound Name | propan-2-yl (2R)-4-[[(4aR,6R,7aR)-7,7-difluoro-6-(4-methyl-2-oxopyrimidin-1-yl)-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate |
|---|---|
| PubChem CID | 134571190 |
| Molecular Formula | C18H25F2N2O8P |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | propan-2-yl (2R)-4-[[(4aR,6R,7aR)-7,7-difluoro-6-(4-methyl-2-oxopyrimidin-1-yl)-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]-2-methylbutanoate |
| SMILES | Cc1ccn([C@@H]2O[C@@H]3COP(=O)(OCC[C@@H](C)C(=O)OC(C)C)O[C@H]3C2(F)F)c(=O)n1 |
| InChI | InChI=1S/C18H25F2N2O8P/c1-10(2)28-15(23)11(3)6-8-26-31(25)27-9-13-14(30-31)18(19,20)16(29-13)22-7-5-12(4)21-17(22)24/h5,7,10-11,13-14,16H,6,8-9H2,1-4H3/t11-,13-,14-,16-,31?/m1/s1 |
| InChIKey | LEJTUZNCBUVDIT-AQNFIRNDSA-N |
| XLogP | 2.60 |
| TPSA | 115.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|