C14H16N4O2 — CID 134571293
N,N-dimethyl-8-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine-2-carboxamide (PubChem CID 134571293) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N,N-dimethyl-8-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine-2-carboxamide.
| Compound Name | N,N-dimethyl-8-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 134571293 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N,N-dimethyl-8-phenyl-6,8-dihydro-5H-[1,2,4]triazolo[5,1-c][1,4]oxazine-2-carboxamide |
| SMILES | CN(C)C(=O)c1nc2n(n1)CCOC2c1ccccc1 |
| InChI | InChI=1S/C14H16N4O2/c1-17(2)14(19)12-15-13-11(10-6-4-3-5-7-10)20-9-8-18(13)16-12/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | MACWRBPKHLHAAA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |