C16H22FN3 — CID 134571886
(5S,7S)-2-tert-butyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 134571886) has the molecular formula C16H22FN3 and a molecular weight of 275.37 g/mol. Its IUPAC name is (5S,7S)-2-tert-butyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-2-tert-butyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 134571886 |
| Molecular Formula | C16H22FN3 |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | (5S,7S)-2-tert-butyl-7-fluoro-5-(1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | CC(C)(C)c1nc2n(n1)[C@H](C1(C)C=CC=CC1)C[C@@H]2F |
| InChI | InChI=1S/C16H22FN3/c1-15(2,3)14-18-13-11(17)10-12(20(13)19-14)16(4)8-6-5-7-9-16/h5-8,11-12H,9-10H2,1-4H3/t11-,12-,16?/m0/s1 |
| InChIKey | GFLHFWNKRQDHLJ-YSWZKLOHSA-N |
| XLogP | 4.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |