C23H40N6O5 — CID 134572232
(2S)-5-(carbamoylamino)-2-[[(2S)-2-[[6-(2,5-dioxopyrrol-1-yl)-3-methylhexan-3-yl]amino]-3-methylbutanoyl]amino]-N-methylpentanamide (PubChem CID 134572232) has the molecular formula C23H40N6O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is (2S)-5-(carbamoylamino)-2-[[(2S)-2-[[6-(2,5-dioxopyrrol-1-yl)-3-methylhexan-3-yl]amino]-3-methylbutanoyl]amino]-N-methylpentanamide.
| Compound Name | (2S)-5-(carbamoylamino)-2-[[(2S)-2-[[6-(2,5-dioxopyrrol-1-yl)-3-methylhexan-3-yl]amino]-3-methylbutanoyl]amino]-N-methylpentanamide |
|---|---|
| PubChem CID | 134572232 |
| Molecular Formula | C23H40N6O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | (2S)-5-(carbamoylamino)-2-[[(2S)-2-[[6-(2,5-dioxopyrrol-1-yl)-3-methylhexan-3-yl]amino]-3-methylbutanoyl]amino]-N-methylpentanamide |
| SMILES | CCC(C)(CCCN1C(=O)C=CC1=O)N[C@H](C(=O)N[C@@H](CCCNC(N)=O)C(=O)NC)C(C)C |
| InChI | InChI=1S/C23H40N6O5/c1-6-23(4,12-8-14-29-17(30)10-11-18(29)31)28-19(15(2)3)21(33)27-16(20(32)25-5)9-7-13-26-22(24)34/h10-11,15-16,19,28H,6-9,12-14H2,1-5H3,(H,25,32)(H,27,33)(H3,24,26,34)/t16-,19-,23?/m0/s1 |
| InChIKey | OJIZBYBSZILQHE-CMJKEJBNSA-N |
| XLogP | 0.15 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|