About (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole
(2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole (PubChem CID 134572607) has the molecular formula C21H28NOP
and a molecular weight of 341.44 g/mol. Its IUPAC name is (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole.
Molecular Properties
| Compound Name | (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole |
| PubChem CID | 134572607 |
| Molecular Formula | C21H28NOP |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole |
| SMILES | COc1cccc2c1[P@](C(C)(C)C)[C@@H](C(C)C)N2c1ccccc1 |
| InChI | InChI=1S/C21H28NOP/c1-15(2)20-22(16-11-8-7-9-12-16)17-13-10-14-18(23-6)19(17)24(20)21(3,4)5/h7-15,20H,1-6H3/t20-,24-/m0/s1 |
| InChIKey | IRGDJQDBKQCYFH-RDPSFJRHSA-N |
| XLogP | 5.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole?
The IUPAC name of (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole (CID 134572607) is (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole.
What is the SMILES notation for (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole?
The canonical SMILES for (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole is COc1cccc2c1[P@](C(C)(C)C)[C@@H](C(C)C)N2c1ccccc1.
What is the InChIKey of (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole?
The InChIKey is IRGDJQDBKQCYFH-RDPSFJRHSA-N. The full InChI is InChI=1S/C21H28NOP/c1-15(2)20-22(16-11-8-7-9-12-16)17-13-10-14-18(23-6)19(17)24(20)21(3,4)5/h7-15,20H,1-6H3/t20-,24-/m0/s1.
What are the key properties of (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole?
(2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole has a molecular weight of 341.44 g/mol, XLogP of 5.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-tert-butyl-4-methoxy-1-phenyl-2-propan-2-yl-2H-1,3-benzazaphosphole is sourced from PubChem (CID 134572607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).