C36H44NO2P — CID 134572619
(2S,3S)-2-(1-adamantylmethyl)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-1-phenyl-2H-1,3-benzazaphosphole (PubChem CID 134572619) has the molecular formula C36H44NO2P and a molecular weight of 553.73 g/mol. Its IUPAC name is (2S,3S)-2-(1-adamantylmethyl)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-1-phenyl-2H-1,3-benzazaphosphole.
| Compound Name | (2S,3S)-2-(1-adamantylmethyl)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-1-phenyl-2H-1,3-benzazaphosphole |
|---|---|
| PubChem CID | 134572619 |
| Molecular Formula | C36H44NO2P |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.31 |
| IUPAC Name | (2S,3S)-2-(1-adamantylmethyl)-3-tert-butyl-4-(2,6-dimethoxyphenyl)-1-phenyl-2H-1,3-benzazaphosphole |
| SMILES | COc1cccc(OC)c1-c1cccc2c1[P@](C(C)(C)C)[C@@H](CC13CC4CC(CC(C4)C1)C3)N2c1ccccc1 |
| InChI | InChI=1S/C36H44NO2P/c1-35(2,3)40-32(23-36-20-24-17-25(21-36)19-26(18-24)22-36)37(27-11-7-6-8-12-27)29-14-9-13-28(34(29)40)33-30(38-4)15-10-16-31(33)39-5/h6-16,24-26,32H,17-23H2,1-5H3/t24?,25?,26?,32-,36?,40+/m0/s1 |
| InChIKey | ADIBQEOYGPZBOM-GPGXWKFHSA-N |
| XLogP | 9.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|