C21H35N7O6S — CID 134573114
4,7,10,13,16,19-hexamethyl-21-thia-3,6,9,12,15,18,23-heptazabicyclo[18.2.1]tricosane-2,5,8,11,14,17-hexone (PubChem CID 134573114) has the molecular formula C21H35N7O6S and a molecular weight of 513.62 g/mol. Its IUPAC name is 4,7,10,13,16,19-hexamethyl-21-thia-3,6,9,12,15,18,23-heptazabicyclo[18.2.1]tricosane-2,5,8,11,14,17-hexone.
| Compound Name | 4,7,10,13,16,19-hexamethyl-21-thia-3,6,9,12,15,18,23-heptazabicyclo[18.2.1]tricosane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 134573114 |
| Molecular Formula | C21H35N7O6S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 4,7,10,13,16,19-hexamethyl-21-thia-3,6,9,12,15,18,23-heptazabicyclo[18.2.1]tricosane-2,5,8,11,14,17-hexone |
| SMILES | CC1NC(=O)C(C)NC(=O)C(C)NC(=O)C2CSC(N2)C(C)NC(=O)C(C)NC(=O)C(C)NC1=O |
| InChI | InChI=1S/C21H35N7O6S/c1-8-15(29)23-9(2)17(31)25-11(4)19(33)27-13(6)21-28-14(7-35-21)20(34)26-12(5)18(32)24-10(3)16(30)22-8/h8-14,21,28H,7H2,1-6H3,(H,22,30)(H,23,29)(H,24,32)(H,25,31)(H,26,34)(H,27,33) |
| InChIKey | PCUWLQHNVSDAFL-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 186.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |