C39H25N3O2S — CID 134573418
4-[7-[2-[10-[2-[4-(dimethylamino)phenyl]ethynyl]anthracen-9-yl]ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid (PubChem CID 134573418) has the molecular formula C39H25N3O2S and a molecular weight of 599.72 g/mol. Its IUPAC name is 4-[7-[2-[10-[2-[4-(dimethylamino)phenyl]ethynyl]anthracen-9-yl]ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid.
| Compound Name | 4-[7-[2-[10-[2-[4-(dimethylamino)phenyl]ethynyl]anthracen-9-yl]ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 134573418 |
| Molecular Formula | C39H25N3O2S |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | 4-[7-[2-[10-[2-[4-(dimethylamino)phenyl]ethynyl]anthracen-9-yl]ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid |
| SMILES | CN(C)c1ccc(C#Cc2c3ccccc3c(C#Cc3ccc(-c4ccc(C(=O)O)cc4)c4nsnc34)c3ccccc23)cc1 |
| InChI | InChI=1S/C39H25N3O2S/c1-42(2)29-20-11-25(12-21-29)13-22-35-31-7-3-5-9-33(31)36(34-10-6-4-8-32(34)35)24-19-27-18-23-30(38-37(27)40-45-41-38)26-14-16-28(17-15-26)39(43)44/h3-12,14-18,20-21,23H,1-2H3,(H,43,44) |
| InChIKey | BYNSSHAETQPDIG-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|