C43H29N3O2S — CID 134573419
4-[7-[2-[10-(4-methyl-N-(4-methylphenyl)anilino)anthracen-9-yl]ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid (PubChem CID 134573419) has the molecular formula C43H29N3O2S and a molecular weight of 651.79 g/mol. Its IUPAC name is 4-[7-[2-[10-(4-methyl-N-(4-methylphenyl)anilino)anthracen-9-yl]ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid.
| Compound Name | 4-[7-[2-[10-(4-methyl-N-(4-methylphenyl)anilino)anthracen-9-yl]ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 134573419 |
| Molecular Formula | C43H29N3O2S |
| Molecular Weight | 651.79 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | 4-[7-[2-[10-(4-methyl-N-(4-methylphenyl)anilino)anthracen-9-yl]ethynyl]-2,1,3-benzothiadiazol-4-yl]benzoic acid |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2c3ccccc3c(C#Cc3ccc(-c4ccc(C(=O)O)cc4)c4nsnc34)c3ccccc23)cc1 |
| InChI | InChI=1S/C43H29N3O2S/c1-27-11-21-32(22-12-27)46(33-23-13-28(2)14-24-33)42-38-9-5-3-7-35(38)37(36-8-4-6-10-39(36)42)26-20-30-19-25-34(41-40(30)44-49-45-41)29-15-17-31(18-16-29)43(47)48/h3-19,21-25H,1-2H3,(H,47,48) |
| InChIKey | ANHUKTCBLWXOFP-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.79 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|