About [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol
[3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol (PubChem CID 13457366) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol.
Molecular Properties
| Compound Name | [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol |
| PubChem CID | 13457366 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol |
| SMILES | COC(CC1C(CO)C1(C)C)OC |
| InChI | InChI=1S/C10H20O3/c1-10(2)7(8(10)6-11)5-9(12-3)13-4/h7-9,11H,5-6H2,1-4H3 |
| InChIKey | IVFIVADDYKRLKE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol?
The IUPAC name of [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol (CID 13457366) is [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol.
What is the SMILES notation for [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol?
The canonical SMILES for [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol is COC(CC1C(CO)C1(C)C)OC.
What is the InChIKey of [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol?
The InChIKey is IVFIVADDYKRLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-10(2)7(8(10)6-11)5-9(12-3)13-4/h7-9,11H,5-6H2,1-4H3.
What are the key properties of [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol?
[3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol has a molecular weight of 188.27 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2,2-dimethoxyethyl)-2,2-dimethylcyclopropyl]methanol is sourced from PubChem (CID 13457366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).