C19H22O3 — CID 134574173
(1R,2S,5E,8E)-2,6,10,10-tetramethyl-16-oxatricyclo[10.3.1.04,15]hexadeca-3,5,8,12-tetraene-7,14-dione (PubChem CID 134574173) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (1R,2S,5E,8E)-2,6,10,10-tetramethyl-16-oxatricyclo[10.3.1.04,15]hexadeca-3,5,8,12-tetraene-7,14-dione.
| Compound Name | (1R,2S,5E,8E)-2,6,10,10-tetramethyl-16-oxatricyclo[10.3.1.04,15]hexadeca-3,5,8,12-tetraene-7,14-dione |
|---|---|
| PubChem CID | 134574173 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (1R,2S,5E,8E)-2,6,10,10-tetramethyl-16-oxatricyclo[10.3.1.04,15]hexadeca-3,5,8,12-tetraene-7,14-dione |
| SMILES | C/C1=C/C2=C[C@H](C)[C@H]3OC(=CC(=O)C23)CC(C)(C)/C=C\C1=O |
| InChI | InChI=1S/C19H22O3/c1-11-7-13-8-12(2)18-17(13)16(21)9-14(22-18)10-19(3,4)6-5-15(11)20/h5-9,12,17-18H,10H2,1-4H3/b6-5-,11-7-/t12-,17?,18+/m0/s1 |
| InChIKey | FDUXFLCDXUNROJ-POSJJSHBSA-N |
| XLogP | 3.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |