C17H27NO — CID 134574390
(2E)-1-[4,4-dimethyl-1-(2-methylpropyl)-2,3-dihydropyridin-5-yl]hexa-2,4-dien-1-one (PubChem CID 134574390) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (2E)-1-[4,4-dimethyl-1-(2-methylpropyl)-2,3-dihydropyridin-5-yl]hexa-2,4-dien-1-one.
| Compound Name | (2E)-1-[4,4-dimethyl-1-(2-methylpropyl)-2,3-dihydropyridin-5-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 134574390 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (2E)-1-[4,4-dimethyl-1-(2-methylpropyl)-2,3-dihydropyridin-5-yl]hexa-2,4-dien-1-one |
| SMILES | CC=C/C=C/C(=O)C1=CN(CC(C)C)CCC1(C)C |
| InChI | InChI=1S/C17H27NO/c1-6-7-8-9-16(19)15-13-18(12-14(2)3)11-10-17(15,4)5/h6-9,13-14H,10-12H2,1-5H3/b7-6?,9-8+ |
| InChIKey | RFQCNOLIOHWZID-ANYPYVPJSA-N |
| XLogP | 3.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|