C66H72N4O2 — CID 134574571
2,6-ditert-butyl-4-[5-(3,5-ditert-butyl-4-hydroxyphenyl)-2,3,7,8-tetrakis(4-methylphenyl)-5,10-dihydropyrazino[2,3-g]quinoxalin-10-yl]phenol (PubChem CID 134574571) has the molecular formula C66H72N4O2 and a molecular weight of 953.33 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[5-(3,5-ditert-butyl-4-hydroxyphenyl)-2,3,7,8-tetrakis(4-methylphenyl)-5,10-dihydropyrazino[2,3-g]quinoxalin-10-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[5-(3,5-ditert-butyl-4-hydroxyphenyl)-2,3,7,8-tetrakis(4-methylphenyl)-5,10-dihydropyrazino[2,3-g]quinoxalin-10-yl]phenol |
|---|---|
| PubChem CID | 134574571 |
| Molecular Formula | C66H72N4O2 |
| Molecular Weight | 953.33 g/mol |
| Exact Mass | 952.57 |
| IUPAC Name | 2,6-ditert-butyl-4-[5-(3,5-ditert-butyl-4-hydroxyphenyl)-2,3,7,8-tetrakis(4-methylphenyl)-5,10-dihydropyrazino[2,3-g]quinoxalin-10-yl]phenol |
| SMILES | Cc1ccc(-c2nc3c(nc2-c2ccc(C)cc2)C(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2nc(-c4ccc(C)cc4)c(-c4ccc(C)cc4)nc2C3c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C66H72N4O2/c1-37-17-25-41(26-18-37)53-54(42-27-19-38(2)20-28-42)68-58-52(46-35-49(65(11,12)13)62(72)50(36-46)66(14,15)16)60-59(51(57(58)67-53)45-33-47(63(5,6)7)61(71)48(34-45)64(8,9)10)69-55(43-29-21-39(3)22-30-43)56(70-60)44-31-23-40(4)24-32-44/h17-36,51-52,71-72H,1-16H3 |
| InChIKey | WXIJORKEWMJMPF-UHFFFAOYSA-N |
| XLogP | 16.44 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.33 |
| LogP ≤ 5 | 16.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |