C9H3F15O2 — CID 134574761
1-[(Z)-1,2-difluoroprop-1-enoxy]-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propane (PubChem CID 134574761) has the molecular formula C9H3F15O2 and a molecular weight of 428.09 g/mol. Its IUPAC name is 1-[(Z)-1,2-difluoroprop-1-enoxy]-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propane.
| Compound Name | 1-[(Z)-1,2-difluoroprop-1-enoxy]-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propane |
|---|---|
| PubChem CID | 134574761 |
| Molecular Formula | C9H3F15O2 |
| Molecular Weight | 428.09 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 1-[(Z)-1,2-difluoroprop-1-enoxy]-1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propane |
| SMILES | C/C(F)=C(/F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H3F15O2/c1-2(10)3(11)25-9(23,24)5(14,7(18,19)20)26-8(21,22)4(12,13)6(15,16)17/h1H3/b3-2+ |
| InChIKey | HYSCEFQOKVXHRF-NSCUHMNNSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.09 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|